diff --git a/src/main/resources/static/assets/web/css/style.css b/src/main/resources/static/assets/web/css/style.css index 73984f9..08c16ce 100644 --- a/src/main/resources/static/assets/web/css/style.css +++ b/src/main/resources/static/assets/web/css/style.css @@ -6,7 +6,7 @@ .nav{width:1200px;margin:-50px auto 0;position:relative;padding:20px 0;background:#fff;-webkit-box-shadow:0 0 10px #eee;box-shadow:0 0 10px #eee;border-radius:5px} .nav ul li{width:200px;float:left;-webkit-box-sizing:border-box;box-sizing:border-box;border-right:1px solid #d2d2d2;cursor:pointer;overflow: hidden} .nav.child ul li{width: 240px;} -.nav ul li .left{width: 100px;} +.nav ul li .left{width: 100px;text-align: center;} .nav.child .left{width: 125px;} .nav.child ul li.active .left{width: 150px;} .nav ul li.active .left{text-align: center} @@ -25,7 +25,7 @@ .nav ul li.active .left span{color:#3d41b7;font-weight:700;line-height:60px;margin-top:0;position:relative;display: inline-block} .nav ul li.active .left span:after{content:'';display:block;width:100%;height:2px;background:#3d41b7;position:absolute;left:0;bottom:10px} .nav ul li.active .left p{display:none} -.mid-link{background: #fff;width:1200px;margin:20px auto;padding-top: 10px;-webkit-box-shadow:0 0 10px #eee;box-shadow:0 0 10px #eee;padding-bottom:30px} +.mid-link{border-radius: 5px;background: #fff;width:1200px;margin:20px auto;padding-top: 10px;-webkit-box-shadow:0 0 10px #eee;box-shadow:0 0 10px #eee;padding-bottom:30px} .mid-link .text{display:block;margin:0 0 15px 15px} .mid-link .link{padding:0 30px;overflow:hidden} .mid-link .link .link-box{float:left;width:23.25%;height:120px;margin-right:2%;cursor:pointer;display:block} @@ -111,10 +111,12 @@ .count-box span{font-size:26px;color:#fff;font-weight:700} .count-box p{font-size:16px;color:#fff} .assessment-main{width:1200px;margin:0 auto 30px;position: relative} -.left-nav{float:left;background:#fff;width:260px;box-shadow:0 0 10px #eee;padding:15px;box-sizing:border-box;height:100%;border-radius:5px;position: absolute;} +.shadow{position: absolute;top:0;right:0;bottom: 0;width: 10px;background: #fff;z-index: 1000} +.left-nav{float:left;overflow: hidden;background:#fff;width:260px;box-shadow:0 0 10px #eee;padding:15px;box-sizing:border-box;height:100%;border-radius:5px;padding-right: 0;} +.nav-container{max-height: 665px;overflow-y: scroll;position: relative;width: 280px;} .nav-title{padding-bottom:10px;border-bottom:1px solid #ddd} .nav-title span{display:inline-block;padding-left:10px;border-left:5px solid #3d41b7;font-size:16px;color:#333;font-weight:400} -.nav-tab{border-bottom:1px dashed #ddd;padding:0 10px} +.nav-tab{border-bottom:1px dashed #ddd;padding:0 10px;width: 228px;box-sizing: border-box;white-space: nowrap;overflow: hidden;text-overflow: ellipsis} .nav-tab .tab-title.active{color:#3d41b7;} .nav-tab .tab-title.bordered{border-bottom:1px dashed #ddd} .tab-title{line-height:60px;font-weight:700;font-size:16px;color:#333;cursor:pointer} diff --git a/src/main/resources/static/assets/web/js/nicescroll.js b/src/main/resources/static/assets/web/js/nicescroll.js new file mode 100644 index 0000000..f8c2da9 --- /dev/null +++ b/src/main/resources/static/assets/web/js/nicescroll.js @@ -0,0 +1,3729 @@ +/* jquery.nicescroll +-- version 3.7.6 +-- copyright 2017-07-19 InuYaksa*2017 +-- licensed under the MIT +-- +-- https://nicescroll.areaaperta.com/ +-- https://github.com/inuyaksa/jquery.nicescroll +-- +*/ + +/* jshint expr: true */ + +(function (factory) { + if (typeof define === 'function' && define.amd) { + // AMD. Register as anonymous module. + define(['jquery'], factory); + } else if (typeof exports === 'object') { + // Node/CommonJS. + module.exports = factory(require('jquery')); + } else { + // Browser globals. + factory(jQuery); + } +}(function (jQuery) { + + "use strict"; + + // globals + var domfocus = false, + mousefocus = false, + tabindexcounter = 0, + ascrailcounter = 2000, + globalmaxzindex = 0; + + var $ = jQuery, // sandbox + _doc = document, + _win = window, + $window = $(_win); + + var delegatevents = []; + + // http://stackoverflow.com/questions/2161159/get-script-path + function getScriptPath() { + var scripts = _doc.currentScript || (function () { var s = _doc.getElementsByTagName('script'); return (s.length) ? s[s.length - 1] : false; })(); + var path = scripts ? scripts.src.split('?')[0] : ''; + return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : ''; + } + + // based on code by Paul Irish https://www.paulirish.com/2011/requestanimationframe-for-smart-animating/ + var setAnimationFrame = _win.requestAnimationFrame || _win.webkitRequestAnimationFrame || _win.mozRequestAnimationFrame || false; + var clearAnimationFrame = _win.cancelAnimationFrame || _win.webkitCancelAnimationFrame || _win.mozCancelAnimationFrame || false; + + if (!setAnimationFrame) { + var anilasttime = 0; + setAnimationFrame = function (callback, element) { + var currTime = new Date().getTime(); + var timeToCall = Math.max(0, 16 - (currTime - anilasttime)); + var id = _win.setTimeout(function () { callback(currTime + timeToCall); }, + timeToCall); + anilasttime = currTime + timeToCall; + return id; + }; + clearAnimationFrame = function (id) { + _win.clearTimeout(id); + }; + } else { + if (!_win.cancelAnimationFrame) clearAnimationFrame = function (id) { }; + } + + var ClsMutationObserver = _win.MutationObserver || _win.WebKitMutationObserver || false; + + var now = Date.now || function () { return new Date().getTime(); }; + + var _globaloptions = { + zindex: "auto", + cursoropacitymin: 0, + cursoropacitymax: 1, + cursorcolor: "#424242", + cursorwidth: "6px", + cursorborder: "1px solid #fff", + cursorborderradius: "5px", + scrollspeed: 40, + mousescrollstep: 9 * 3, + touchbehavior: false, // deprecated + emulatetouch: false, // replacing touchbehavior + hwacceleration: true, + usetransition: true, + boxzoom: false, + dblclickzoom: true, + gesturezoom: true, + grabcursorenabled: true, + autohidemode: true, + background: "", + iframeautoresize: true, + cursorminheight: 32, + preservenativescrolling: true, + railoffset: false, + railhoffset: false, + bouncescroll: true, + spacebarenabled: true, + railpadding: { + top: 0, + right: 0, + left: 0, + bottom: 0 + }, + disableoutline: true, + horizrailenabled: true, + railalign: "right", + railvalign: "bottom", + enabletranslate3d: true, + enablemousewheel: true, + enablekeyboard: true, + smoothscroll: true, + sensitiverail: true, + enablemouselockapi: true, + // cursormaxheight:false, + cursorfixedheight: false, + directionlockdeadzone: 6, + hidecursordelay: 400, + nativeparentscrolling: true, + enablescrollonselection: true, + overflowx: true, + overflowy: true, + cursordragspeed: 0.3, + rtlmode: "auto", + cursordragontouch: false, + oneaxismousemode: "auto", + scriptpath: getScriptPath(), + preventmultitouchscrolling: true, + disablemutationobserver: false, + enableobserver: true, + scrollbarid: false, + scrollCLass: false + }; + + var browserdetected = false; + + var getBrowserDetection = function () { + + if (browserdetected) return browserdetected; + + var _el = _doc.createElement('DIV'), + _style = _el.style, + _agent = navigator.userAgent, + _platform = navigator.platform, + d = {}; + + d.haspointerlock = "pointerLockElement" in _doc || "webkitPointerLockElement" in _doc || "mozPointerLockElement" in _doc; + + d.isopera = ("opera" in _win); // 12- + d.isopera12 = (d.isopera && ("getUserMedia" in navigator)); + d.isoperamini = (Object.prototype.toString.call(_win.operamini) === "[object OperaMini]"); + + d.isie = (("all" in _doc) && ("attachEvent" in _el) && !d.isopera); //IE10- + d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older + d.isie7 = d.isie && !d.isieold && (!("documentMode" in _doc) || (_doc.documentMode === 7)); + d.isie8 = d.isie && ("documentMode" in _doc) && (_doc.documentMode === 8); + d.isie9 = d.isie && ("performance" in _win) && (_doc.documentMode === 9); + d.isie10 = d.isie && ("performance" in _win) && (_doc.documentMode === 10); + d.isie11 = ("msRequestFullscreen" in _el) && (_doc.documentMode >= 11); // IE11+ + + d.ismsedge = ("msCredentials" in _win); // MS Edge 14+ + + d.ismozilla = ("MozAppearance" in _style); + + d.iswebkit = !d.ismsedge && ("WebkitAppearance" in _style); + + d.ischrome = d.iswebkit && ("chrome" in _win); + d.ischrome38 = (d.ischrome && ("touchAction" in _style)); // behavior changed in touch emulation + d.ischrome22 = (!d.ischrome38) && (d.ischrome && d.haspointerlock); + d.ischrome26 = (!d.ischrome38) && (d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix) + + d.cantouch = ("ontouchstart" in _doc.documentElement) || ("ontouchstart" in _win); // with detection for Chrome Touch Emulation + d.hasw3ctouch = (_win.PointerEvent || false) && ((navigator.maxTouchPoints > 0) || (navigator.msMaxTouchPoints > 0)); //IE11 pointer events, following W3C Pointer Events spec + d.hasmstouch = (!d.hasw3ctouch) && (_win.MSPointerEvent || false); // IE10 pointer events + + d.ismac = /^mac$/i.test(_platform); + + d.isios = d.cantouch && /iphone|ipad|ipod/i.test(_platform); + d.isios4 = d.isios && !("seal" in Object); + d.isios7 = d.isios && ("webkitHidden" in _doc); //iOS 7+ + d.isios8 = d.isios && ("hidden" in _doc); //iOS 8+ + d.isios10 = d.isios && _win.Proxy; //iOS 10+ + + d.isandroid = (/android/i.test(_agent)); + + d.haseventlistener = ("addEventListener" in _el); + + d.trstyle = false; + d.hastransform = false; + d.hastranslate3d = false; + d.transitionstyle = false; + d.hastransition = false; + d.transitionend = false; + + d.trstyle = "transform"; + d.hastransform = ("transform" in _style) || (function () { + var check = ['msTransform', 'webkitTransform', 'MozTransform', 'OTransform']; + for (var a = 0, c = check.length; a < c; a++) { + if (_style[check[a]] !== undefined) { + d.trstyle = check[a]; + break; + } + } + d.hastransform = (!!d.trstyle); + })(); + + if (d.hastransform) { + _style[d.trstyle] = "translate3d(1px,2px,3px)"; + d.hastranslate3d = /translate3d/.test(_style[d.trstyle]); + } + + d.transitionstyle = "transition"; + d.prefixstyle = ''; + d.transitionend = "transitionend"; + + d.hastransition = ("transition" in _style) || (function () { + + d.transitionend = false; + var check = ['webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition']; + var prefix = ['-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-']; + var evs = ['webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd']; + for (var a = 0, c = check.length; a < c; a++) { + if (check[a] in _style) { + d.transitionstyle = check[a]; + d.prefixstyle = prefix[a]; + d.transitionend = evs[a]; + break; + } + } + if (d.ischrome26) d.prefixstyle = prefix[1]; // always use prefix + + d.hastransition = (d.transitionstyle); + + })(); + + function detectCursorGrab() { + var lst = ['grab', '-webkit-grab', '-moz-grab']; + if ((d.ischrome && !d.ischrome38) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug + for (var a = 0, l = lst.length; a < l; a++) { + var p = lst[a]; + _style.cursor = p; + if (_style.cursor == p) return p; + } + return 'url(https://cdnjs.cloudflare.com/ajax/libs/slider-pro/1.3.0/css/images/openhand.cur),n-resize'; // thanks to https://cdnjs.com/ for the openhand cursor! + } + d.cursorgrabvalue = detectCursorGrab(); + + d.hasmousecapture = ("setCapture" in _el); + + d.hasMutationObserver = (ClsMutationObserver !== false); + + _el = null; //memory released + + browserdetected = d; + + return d; + }; + + var NiceScrollClass = function (myopt, me) { + + var self = this; + + this.version = '3.7.6'; + this.name = 'nicescroll'; + + this.me = me; + + var $body = $("body"); + + var opt = this.opt = { + doc: $body, + win: false + }; + + $.extend(opt, _globaloptions); // clone opts + + // Options for internal use + opt.snapbackspeed = 80; + + if (myopt || false) { + for (var a in opt) { + if (myopt[a] !== undefined) opt[a] = myopt[a]; + } + } + + if (opt.disablemutationobserver) ClsMutationObserver = false; + + this.doc = opt.doc; + this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : ''; + this.ispage = /^BODY|HTML/.test((opt.win) ? opt.win[0].nodeName : this.doc[0].nodeName); + this.haswrapper = (opt.win !== false); + this.win = opt.win || (this.ispage ? $window : this.doc); + this.docscroll = (this.ispage && !this.haswrapper) ? $window : this.win; + this.body = $body; + this.viewport = false; + + this.isfixed = false; + + this.iframe = false; + this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME')); + + this.istextarea = (this.win[0].nodeName == 'TEXTAREA'); + + this.forcescreen = false; //force to use screen position on events + + this.canshowonmouseevent = (opt.autohidemode != "scroll"); + + // Events jump table + this.onmousedown = false; + this.onmouseup = false; + this.onmousemove = false; + this.onmousewheel = false; + this.onkeypress = false; + this.ongesturezoom = false; + this.onclick = false; + + // Nicescroll custom events + this.onscrollstart = false; + this.onscrollend = false; + this.onscrollcancel = false; + + this.onzoomin = false; + this.onzoomout = false; + + // Let's start! + this.view = false; + this.page = false; + + this.scroll = { + x: 0, + y: 0 + }; + this.scrollratio = { + x: 0, + y: 0 + }; + this.cursorheight = 20; + this.scrollvaluemax = 0; + + // http://dev.w3.org/csswg/css-writing-modes-3/#logical-to-physical + // http://dev.w3.org/csswg/css-writing-modes-3/#svg-writing-mode + if (opt.rtlmode == "auto") { + var target = this.win[0] == _win ? this.body : this.win; + var writingMode = target.css("writing-mode") || target.css("-webkit-writing-mode") || target.css("-ms-writing-mode") || target.css("-moz-writing-mode"); + + if (writingMode == "horizontal-tb" || writingMode == "lr-tb" || writingMode === "") { + this.isrtlmode = (target.css("direction") == "rtl"); + this.isvertical = false; + } else { + this.isrtlmode = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl" || writingMode == "rl-tb"); + this.isvertical = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl"); + } + } else { + this.isrtlmode = (opt.rtlmode === true); + this.isvertical = false; + } + // this.checkrtlmode = false; + + this.scrollrunning = false; + + this.scrollmom = false; + + this.observer = false; // observer div changes + this.observerremover = false; // observer on parent for remove detection + this.observerbody = false; // observer on body for position change + + if (opt.scrollbarid !== false) { + this.id = opt.scrollbarid; + } else { + do { + this.id = "ascrail" + (ascrailcounter++); + } while (_doc.getElementById(this.id)); + } + + this.rail = false; + this.cursor = false; + this.cursorfreezed = false; + this.selectiondrag = false; + + this.zoom = false; + this.zoomactive = false; + + this.hasfocus = false; + this.hasmousefocus = false; + + //this.visibility = true; + this.railslocked = false; // locked by resize + this.locked = false; // prevent lost of locked status sets by user + this.hidden = false; // rails always hidden + this.cursoractive = true; // user can interact with cursors + + this.wheelprevented = false; //prevent mousewheel event + + this.overflowx = opt.overflowx; + this.overflowy = opt.overflowy; + + this.nativescrollingarea = false; + this.checkarea = 0; + + this.events = []; // event list for unbind + + this.saved = {}; // style saved + + this.delaylist = {}; + this.synclist = {}; + + this.lastdeltax = 0; + this.lastdeltay = 0; + + this.detected = getBrowserDetection(); + + var cap = $.extend({}, this.detected); + + this.canhwscroll = (cap.hastransform && opt.hwacceleration); + this.ishwscroll = (this.canhwscroll && self.haswrapper); + + if (!this.isrtlmode) { + this.hasreversehr = false; + } else if (this.isvertical) { // RTL mode with reverse horizontal axis + this.hasreversehr = !(cap.iswebkit || cap.isie || cap.isie11); + } else { + this.hasreversehr = !(cap.iswebkit || (cap.isie && !cap.isie10 && !cap.isie11)); + } + + this.istouchcapable = false; // desktop devices with touch screen support + + //## Check WebKit-based desktop with touch support + //## + Firefox 18 nightly build (desktop) false positive (or desktop with touch support) + + if (!cap.cantouch && (cap.hasw3ctouch || cap.hasmstouch)) { // desktop device with multiple input + this.istouchcapable = true; + } else if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) { + this.istouchcapable = true; + } + + //## disable MouseLock API on user request + if (!opt.enablemouselockapi) { + cap.hasmousecapture = false; + cap.haspointerlock = false; + } + + this.debounced = function (name, fn, tm) { + if (!self) return; + var dd = self.delaylist[name] || false; + if (!dd) { + self.delaylist[name] = { + h: setAnimationFrame(function () { + self.delaylist[name].fn.call(self); + self.delaylist[name] = false; + }, tm) + }; + fn.call(self); + } + self.delaylist[name].fn = fn; + }; + + + this.synched = function (name, fn) { + if (self.synclist[name]) self.synclist[name] = fn; + else { + self.synclist[name] = fn; + setAnimationFrame(function () { + if (!self) return; + self.synclist[name] && self.synclist[name].call(self); + self.synclist[name] = null; + }); + } + }; + + this.unsynched = function (name) { + if (self.synclist[name]) self.synclist[name] = false; + }; + + this.css = function (el, pars) { // save & set + for (var n in pars) { + self.saved.css.push([el, n, el.css(n)]); + el.css(n, pars[n]); + } + }; + + this.scrollTop = function (val) { + return (val === undefined) ? self.getScrollTop() : self.setScrollTop(val); + }; + + this.scrollLeft = function (val) { + return (val === undefined) ? self.getScrollLeft() : self.setScrollLeft(val); + }; + + // derived by by Dan Pupius www.pupius.net + var BezierClass = function (st, ed, spd, p1, p2, p3, p4) { + + this.st = st; + this.ed = ed; + this.spd = spd; + + this.p1 = p1 || 0; + this.p2 = p2 || 1; + this.p3 = p3 || 0; + this.p4 = p4 || 1; + + this.ts = now(); + this.df = ed - st; + }; + BezierClass.prototype = { + B2: function (t) { + return 3 * (1 - t) * (1 - t) * t; + }, + B3: function (t) { + return 3 * (1 - t) * t * t; + }, + B4: function (t) { + return t * t * t; + }, + getPos: function () { + return (now() - this.ts) / this.spd; + }, + getNow: function () { + var pc = (now() - this.ts) / this.spd; + var bz = this.B2(pc) + this.B3(pc) + this.B4(pc); + return (pc >= 1) ? this.ed : this.st + (this.df * bz) | 0; + }, + update: function (ed, spd) { + this.st = this.getNow(); + this.ed = ed; + this.spd = spd; + this.ts = now(); + this.df = this.ed - this.st; + return this; + } + }; + + //derived from http://stackoverflow.com/questions/11236090/ + function getMatrixValues() { + var tr = self.doc.css(cap.trstyle); + if (tr && (tr.substr(0, 6) == "matrix")) { + return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, '').split(/, +/); + } + return false; + } + + if (this.ishwscroll) { // hw accelerated scroll + + this.doc.translate = { + x: 0, + y: 0, + tx: "0px", + ty: "0px" + }; + + //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/ + if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/ + + this.getScrollTop = function (last) { + if (!last) { + var mtx = getMatrixValues(); + if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10 + if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow(); + } + return self.doc.translate.y; + }; + + this.getScrollLeft = function (last) { + if (!last) { + var mtx = getMatrixValues(); + if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10 + if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow(); + } + return self.doc.translate.x; + }; + + this.notifyScrollEvent = function (el) { + var e = _doc.createEvent("UIEvents"); + e.initUIEvent("scroll", false, false, _win, 1); + e.niceevent = true; + el.dispatchEvent(e); + }; + + var cxscrollleft = (this.isrtlmode) ? 1 : -1; + + if (cap.hastranslate3d && opt.enabletranslate3d) { + this.setScrollTop = function (val, silent) { + self.doc.translate.y = val; + self.doc.translate.ty = (val * -1) + "px"; + self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0)"); + if (!silent) self.notifyScrollEvent(self.win[0]); + }; + this.setScrollLeft = function (val, silent) { + self.doc.translate.x = val; + self.doc.translate.tx = (val * cxscrollleft) + "px"; + self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0)"); + if (!silent) self.notifyScrollEvent(self.win[0]); + }; + } else { + this.setScrollTop = function (val, silent) { + self.doc.translate.y = val; + self.doc.translate.ty = (val * -1) + "px"; + self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")"); + if (!silent) self.notifyScrollEvent(self.win[0]); + }; + this.setScrollLeft = function (val, silent) { + self.doc.translate.x = val; + self.doc.translate.tx = (val * cxscrollleft) + "px"; + self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")"); + if (!silent) self.notifyScrollEvent(self.win[0]); + }; + } + } else { // native scroll + + this.getScrollTop = function () { + return self.docscroll.scrollTop(); + }; + this.setScrollTop = function (val) { + self.docscroll.scrollTop(val); + }; + + this.getScrollLeft = function () { + var val; + if (!self.hasreversehr) { + val = self.docscroll.scrollLeft(); + } else if (self.detected.ismozilla) { + val = self.page.maxw - Math.abs(self.docscroll.scrollLeft()); + } else { + val = self.page.maxw - self.docscroll.scrollLeft(); + } + return val; + }; + this.setScrollLeft = function (val) { + return setTimeout(function () { + if (!self) return; + if (self.hasreversehr) { + if (self.detected.ismozilla) { + val = -(self.page.maxw - val); + } else { + val = self.page.maxw - val; + } + } + return self.docscroll.scrollLeft(val); + }, 1); + }; + } + + this.getTarget = function (e) { + if (!e) return false; + if (e.target) return e.target; + if (e.srcElement) return e.srcElement; + return false; + }; + + this.hasParent = function (e, id) { + if (!e) return false; + var el = e.target || e.srcElement || e || false; + while (el && el.id != id) { + el = el.parentNode || false; + } + return (el !== false); + }; + + function getZIndex() { + var dom = self.win; + if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available + while (dom.length > 0) { + if (dom[0].nodeType == 9) return false; + var zi = dom.css('zIndex'); + if (!isNaN(zi) && zi !== 0) return parseInt(zi); + dom = dom.parent(); + } + return false; + } + + //inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie + var _convertBorderWidth = { + "thin": 1, + "medium": 3, + "thick": 5 + }; + + function getWidthToPixel(dom, prop, chkheight) { + var wd = dom.css(prop); + var px = parseFloat(wd); + if (isNaN(px)) { + px = _convertBorderWidth[wd] || 0; + var brd = (px == 3) ? ((chkheight) ? (self.win.outerHeight() - self.win.innerHeight()) : (self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS + if (self.isie8 && px) px += 1; + return (brd) ? px : 0; + } + return px; + } + + this.getDocumentScrollOffset = function () { + return { + top: _win.pageYOffset || _doc.documentElement.scrollTop, + left: _win.pageXOffset || _doc.documentElement.scrollLeft + }; + }; + + this.getOffset = function () { + if (self.isfixed) { + var ofs = self.win.offset(); // fix Chrome auto issue (when right/bottom props only) + var scrl = self.getDocumentScrollOffset(); + ofs.top -= scrl.top; + ofs.left -= scrl.left; + return ofs; + } + var ww = self.win.offset(); + if (!self.viewport) return ww; + var vp = self.viewport.offset(); + return { + top: ww.top - vp.top, + left: ww.left - vp.left + }; + }; + + this.updateScrollBar = function (len) { + var pos, off; + if (self.ishwscroll) { + self.rail.css({ + height: self.win.innerHeight() - (opt.railpadding.top + opt.railpadding.bottom) + }); + if (self.railh) self.railh.css({ + width: self.win.innerWidth() - (opt.railpadding.left + opt.railpadding.right) + }); + } else { + var wpos = self.getOffset(); + pos = { + top: wpos.top, + left: wpos.left - (opt.railpadding.left + opt.railpadding.right) + }; + pos.top += getWidthToPixel(self.win, 'border-top-width', true); + pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width'); + + off = opt.railoffset; + if (off) { + if (off.top) pos.top += off.top; + if (off.left) pos.left += off.left; + } + + if (!self.railslocked) self.rail.css({ + top: pos.top, + left: pos.left, + height: ((len) ? len.h : self.win.innerHeight()) - (opt.railpadding.top + opt.railpadding.bottom) + }); + + if (self.zoom) { + self.zoom.css({ + top: pos.top + 1, + left: (self.rail.align == 1) ? pos.left - 20 : pos.left + self.rail.width + 4 + }); + } + + if (self.railh && !self.railslocked) { + pos = { + top: wpos.top, + left: wpos.left + }; + off = opt.railhoffset; + if (off) { + if (off.top) pos.top += off.top; + if (off.left) pos.left += off.left; + } + var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true); + var x = pos.left + getWidthToPixel(self.win, 'border-left-width'); + self.railh.css({ + top: y - (opt.railpadding.top + opt.railpadding.bottom), + left: x, + width: self.railh.width + }); + } + + } + }; + + this.doRailClick = function (e, dbl, hr) { + var fn, pg, cur, pos; + + if (self.railslocked) return; + + self.cancelEvent(e); + + if (!("pageY" in e)) { + e.pageX = e.clientX + _doc.documentElement.scrollLeft; + e.pageY = e.clientY + _doc.documentElement.scrollTop; + } + + if (dbl) { + fn = (hr) ? self.doScrollLeft : self.doScrollTop; + cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y); + self.unsynched("relativexy"); + fn(cur|0); + } else { + fn = (hr) ? self.doScrollLeftBy : self.doScrollBy; + cur = (hr) ? self.scroll.x : self.scroll.y; + pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top; + pg = (hr) ? self.view.w : self.view.h; + fn((cur >= pos) ? pg : -pg); + } + + }; + + self.newscrolly = self.newscrollx = 0; + + self.hasanimationframe = ("requestAnimationFrame" in _win); + self.hascancelanimationframe = ("cancelAnimationFrame" in _win); + + self.hasborderbox = false; + + this.init = function () { + + self.saved.css = []; + + if (cap.isoperamini) return true; // SORRY, DO NOT WORK! + if (cap.isandroid && !("hidden" in _doc)) return true; // Android 3- SORRY, DO NOT WORK! + + opt.emulatetouch = opt.emulatetouch || opt.touchbehavior; // mantain compatibility with "touchbehavior" + + self.hasborderbox = _win.getComputedStyle && (_win.getComputedStyle(_doc.body)['box-sizing'] === "border-box"); + + var _scrollyhidden = { 'overflow-y': 'hidden' }; + if (cap.isie11 || cap.isie10) _scrollyhidden['-ms-overflow-style'] = 'none'; // IE 10 & 11 is always a world apart! + + if (self.ishwscroll) { + this.doc.css(cap.transitionstyle, cap.prefixstyle + 'transform 0ms ease-out'); + if (cap.transitionend) self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!! + } + + self.zindex = "auto"; + if (!self.ispage && opt.zindex == "auto") { + self.zindex = getZIndex() || "auto"; + } else { + self.zindex = opt.zindex; + } + + if (!self.ispage && self.zindex != "auto" && self.zindex > globalmaxzindex) { + globalmaxzindex = self.zindex; + } + + if (self.isie && self.zindex === 0 && opt.zindex == "auto") { // fix IE auto == 0 + self.zindex = "auto"; + } + + if (!self.ispage || !cap.isieold) { + + var cont = self.docscroll; + if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc; + + self.css(cont, _scrollyhidden); + + if (self.ispage && (cap.isie11 || cap.isie)) { // IE 7-11 + self.css($("html"), _scrollyhidden); + } + + if (cap.isios && !self.ispage && !self.haswrapper) self.css($body, { + "-webkit-overflow-scrolling": "touch" + }); //force hw acceleration + + var cursor = $(_doc.createElement('div')); + cursor.css({ + position: "relative", + top: 0, + "float": "right", + width: opt.cursorwidth, + height: 0, + 'background-color': opt.cursorcolor, + border: opt.cursorborder, + 'background-clip': 'padding-box', + '-webkit-border-radius': opt.cursorborderradius, + '-moz-border-radius': opt.cursorborderradius, + 'border-radius': opt.cursorborderradius + }); + + cursor.addClass('nicescroll-cursors'); + + self.cursor = cursor; + + var rail = $(_doc.createElement('div')); + rail.attr('id', self.id); + rail.addClass('nicescroll-rails nicescroll-rails-vr'); + + if (opt.scrollCLass) { + rail.addClass(opt.scrollCLass); + } + + var v, a, kp = ["left", "right", "top", "bottom"]; //** + for (var n in kp) { + a = kp[n]; + v = opt.railpadding[a] || 0; + v && rail.css("padding-" + a, v + "px"); + } + + rail.append(cursor); + + rail.width = Math.max(parseFloat(opt.cursorwidth), cursor.outerWidth()); + rail.css({ + width: rail.width + "px", + zIndex: self.zindex, + background: opt.background, + cursor: "default" + }); + + rail.visibility = true; + rail.scrollable = true; + + rail.align = (opt.railalign == "left") ? 0 : 1; + + self.rail = rail; + + self.rail.drag = false; + + var zoom = false; + if (opt.boxzoom && !self.ispage && !cap.isieold) { + zoom = _doc.createElement('div'); + + self.bind(zoom, "click", self.doZoom); + self.bind(zoom, "mouseenter", function () { + self.zoom.css('opacity', opt.cursoropacitymax); + }); + self.bind(zoom, "mouseleave", function () { + self.zoom.css('opacity', opt.cursoropacitymin); + }); + + self.zoom = $(zoom); + self.zoom.css({ + cursor: "pointer", + zIndex: self.zindex, + backgroundImage: 'url(' + opt.scriptpath + 'zoomico.png)', + height: 18, + width: 18, + backgroundPosition: '0 0' + }); + if (opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom); + if (cap.cantouch && opt.gesturezoom) { + self.ongesturezoom = function (e) { + if (e.scale > 1.5) self.doZoomIn(e); + if (e.scale < 0.8) self.doZoomOut(e); + return self.cancelEvent(e); + }; + self.bind(self.win, "gestureend", self.ongesturezoom); + } + } + + // init HORIZ + + self.railh = false; + var railh; + + if (opt.horizrailenabled) { + + self.css(cont, { + overflowX: 'hidden' + }); + + cursor = $(_doc.createElement('div')); + cursor.css({ + position: "absolute", + top: 0, + height: opt.cursorwidth, + width: 0, + backgroundColor: opt.cursorcolor, + border: opt.cursorborder, + backgroundClip: 'padding-box', + '-webkit-border-radius': opt.cursorborderradius, + '-moz-border-radius': opt.cursorborderradius, + 'border-radius': opt.cursorborderradius + }); + + if (cap.isieold) cursor.css('overflow', 'hidden'); //IE6 horiz scrollbar issue + + cursor.addClass('nicescroll-cursors'); + + self.cursorh = cursor; + + railh = $(_doc.createElement('div')); + railh.attr('id', self.id + '-hr'); + railh.addClass('nicescroll-rails nicescroll-rails-hr'); + if (opt.scrollCLass) { + railh.addClass(opt.scrollCLass); + } + + railh.height = Math.max(parseFloat(opt.cursorwidth), cursor.outerHeight()); + railh.css({ + height: railh.height + "px", + 'zIndex': self.zindex, + "background": opt.background + }); + + railh.append(cursor); + + railh.visibility = true; + railh.scrollable = true; + + railh.align = (opt.railvalign == "top") ? 0 : 1; + + self.railh = railh; + + self.railh.drag = false; + + } + + if (self.ispage) { + + rail.css({ + position: "fixed", + top: 0, + height: "100%" + }); + + rail.css((rail.align) ? { right: 0 } : { left: 0 }); + + self.body.append(rail); + if (self.railh) { + railh.css({ + position: "fixed", + left: 0, + width: "100%" + }); + + railh.css((railh.align) ? { bottom: 0 } : { top: 0 }); + + self.body.append(railh); + } + } else { + if (self.ishwscroll) { + if (self.win.css('position') == 'static') self.css(self.win, { 'position': 'relative' }); + var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win; + $(bd).scrollTop(0).scrollLeft(0); // fix rail position if content already scrolled + if (self.zoom) { + self.zoom.css({ + position: "absolute", + top: 1, + right: 0, + "margin-right": rail.width + 4 + }); + bd.append(self.zoom); + } + rail.css({ + position: "absolute", + top: 0 + }); + rail.css((rail.align) ? { right: 0 } : { left: 0 }); + bd.append(rail); + if (railh) { + railh.css({ + position: "absolute", + left: 0, + bottom: 0 + }); + railh.css((railh.align) ? { bottom: 0 } : { top: 0 }); + bd.append(railh); + } + } else { + self.isfixed = (self.win.css("position") == "fixed"); + var rlpos = (self.isfixed) ? "fixed" : "absolute"; + + if (!self.isfixed) self.viewport = self.getViewport(self.win[0]); + if (self.viewport) { + self.body = self.viewport; + if (!(/fixed|absolute/.test(self.viewport.css("position")))) self.css(self.viewport, { + "position": "relative" + }); + } + + rail.css({ + position: rlpos + }); + if (self.zoom) self.zoom.css({ + position: rlpos + }); + self.updateScrollBar(); + self.body.append(rail); + if (self.zoom) self.body.append(self.zoom); + if (self.railh) { + railh.css({ + position: rlpos + }); + self.body.append(railh); + } + } + + if (cap.isios) self.css(self.win, { + '-webkit-tap-highlight-color': 'rgba(0,0,0,0)', + '-webkit-touch-callout': 'none' + }); // prevent grey layer on click + + if (opt.disableoutline) { + if (cap.isie) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div + if (cap.iswebkit) self.win.css('outline', 'none'); // Webkit outline + } + + } + + if (opt.autohidemode === false) { + self.autohidedom = false; + self.rail.css({ + opacity: opt.cursoropacitymax + }); + if (self.railh) self.railh.css({ + opacity: opt.cursoropacitymax + }); + } else if ((opt.autohidemode === true) || (opt.autohidemode === "leave")) { + self.autohidedom = $().add(self.rail); + if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor); + if (self.railh) self.autohidedom = self.autohidedom.add(self.railh); + if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh); + } else if (opt.autohidemode == "scroll") { + self.autohidedom = $().add(self.rail); + if (self.railh) self.autohidedom = self.autohidedom.add(self.railh); + } else if (opt.autohidemode == "cursor") { + self.autohidedom = $().add(self.cursor); + if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh); + } else if (opt.autohidemode == "hidden") { + self.autohidedom = false; + self.hide(); + self.railslocked = false; + } + + if (cap.cantouch || self.istouchcapable || opt.emulatetouch || cap.hasmstouch) { + + self.scrollmom = new ScrollMomentumClass2D(self); + + var delayedclick = null; + + self.ontouchstart = function (e) { + + if (self.locked) return false; + + //if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false; + if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return false; // need test on surface!! + + self.hasmoving = false; + + if (self.scrollmom.timer) { + self.triggerScrollEnd(); + self.scrollmom.stop(); + } + + if (!self.railslocked) { + var tg = self.getTarget(e); + + if (tg) { + var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type)); + if (skp) return self.stopPropagation(e); + } + + var ismouse = (e.type === "mousedown"); + + if (!("clientX" in e) && ("changedTouches" in e)) { + e.clientX = e.changedTouches[0].clientX; + e.clientY = e.changedTouches[0].clientY; + } + + if (self.forcescreen) { + var le = e; + e = { + "original": (e.original) ? e.original : e + }; + e.clientX = le.screenX; + e.clientY = le.screenY; + } + + self.rail.drag = { + x: e.clientX, + y: e.clientY, + sx: self.scroll.x, + sy: self.scroll.y, + st: self.getScrollTop(), + sl: self.getScrollLeft(), + pt: 2, + dl: false, + tg: tg + }; + + if (self.ispage || !opt.directionlockdeadzone) { + + self.rail.drag.dl = "f"; + + } else { + + var view = { + w: $window.width(), + h: $window.height() + }; + + var page = self.getContentSize(); + + var maxh = page.h - view.h; + var maxw = page.w - view.w; + + if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false; + else if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false; + else self.rail.drag.ck = false; + + } + + if (opt.emulatetouch && self.isiframe && cap.isie) { + var wp = self.win.position(); + self.rail.drag.x += wp.left; + self.rail.drag.y += wp.top; + } + + self.hasmoving = false; + self.lastmouseup = false; + self.scrollmom.reset(e.clientX, e.clientY); + + if (tg&&ismouse) { + + var ip = /INPUT|SELECT|BUTTON|TEXTAREA/i.test(tg.nodeName); + if (!ip) { + if (cap.hasmousecapture) tg.setCapture(); + if (opt.emulatetouch) { + if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event + tg._onclick = tg.onclick; + tg.onclick = function (e) { + if (self.hasmoving) return false; + tg._onclick.call(this, e); + }; + } + return self.cancelEvent(e); + } + return self.stopPropagation(e); + } + + if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) { + self.preventclick = { + "tg": tg, + "click": false + }; + } + + } + } + + }; + + self.ontouchend = function (e) { + + if (!self.rail.drag) return true; + + if (self.rail.drag.pt == 2) { + //if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false; + if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return false; + + self.rail.drag = false; + + var ismouse = (e.type === "mouseup"); + + if (self.hasmoving) { + self.scrollmom.doMomentum(); + self.lastmouseup = true; + self.hideCursor(); + if (cap.hasmousecapture) _doc.releaseCapture(); + if (ismouse) return self.cancelEvent(e); + } + + } + else if (self.rail.drag.pt == 1) { + return self.onmouseup(e); + } + + }; + + var moveneedoffset = (opt.emulatetouch && self.isiframe && !cap.hasmousecapture); + + var locktollerance = opt.directionlockdeadzone * 0.3 | 0; + + self.ontouchmove = function (e, byiframe) { + + if (!self.rail.drag) return true; + + if (e.targetTouches && opt.preventmultitouchscrolling) { + if (e.targetTouches.length > 1) return true; // multitouch + } + + //if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false; + if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return true; + + if (self.rail.drag.pt == 2) { + + if (("changedTouches" in e)) { + e.clientX = e.changedTouches[0].clientX; + e.clientY = e.changedTouches[0].clientY; + } + + var ofy, ofx; + ofx = ofy = 0; + + if (moveneedoffset && !byiframe) { + var wp = self.win.position(); + ofx = -wp.left; + ofy = -wp.top; + } + + var fy = e.clientY + ofy; + var my = (fy - self.rail.drag.y); + var fx = e.clientX + ofx; + var mx = (fx - self.rail.drag.x); + + var ny = self.rail.drag.st - my; + + if (self.ishwscroll && opt.bouncescroll) { + if (ny < 0) { + ny = Math.round(ny / 2); + } else if (ny > self.page.maxh) { + ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2); + } + } else { + if (ny < 0) { + ny = 0; + fy = 0; + } + else if (ny > self.page.maxh) { + ny = self.page.maxh; + fy = 0; + } + if (fy === 0 && !self.hasmoving) { + if (!self.ispage) self.rail.drag = false; + return true; + } + } + + var nx = self.getScrollLeft(); + + if (self.railh && self.railh.scrollable) { + nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx; + + if (self.ishwscroll && opt.bouncescroll) { + if (nx < 0) { + nx = Math.round(nx / 2); + } else if (nx > self.page.maxw) { + nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2); + } + } else { + if (nx < 0) { + nx = 0; + fx = 0; + } + if (nx > self.page.maxw) { + nx = self.page.maxw; + fx = 0; + } + } + + } + + + if (!self.hasmoving) { + + if (self.rail.drag.y === e.clientY && self.rail.drag.x === e.clientX) return self.cancelEvent(e); // prevent first useless move event + + var ay = Math.abs(my); + var ax = Math.abs(mx); + var dz = opt.directionlockdeadzone; + + if (!self.rail.drag.ck) { + if (ay > dz && ax > dz) self.rail.drag.dl = "f"; + else if (ay > dz) self.rail.drag.dl = (ax > locktollerance) ? "f" : "v"; + else if (ax > dz) self.rail.drag.dl = (ay > locktollerance) ? "f" : "h"; + } + else if (self.rail.drag.ck == "v") { + if (ax > dz && ay <= locktollerance) { + self.rail.drag = false; + } + else if (ay > dz) self.rail.drag.dl = "v"; + + } + else if (self.rail.drag.ck == "h") { + + if (ay > dz && ax <= locktollerance) { + self.rail.drag = false; + } + else if (ax > dz) self.rail.drag.dl = "h"; + + } + + if (!self.rail.drag.dl) return self.cancelEvent(e); + + self.triggerScrollStart(e.clientX, e.clientY, 0, 0, 0); + self.hasmoving = true; + } + + if (self.preventclick && !self.preventclick.click) { + self.preventclick.click = self.preventclick.tg.onclick || false; + self.preventclick.tg.onclick = self.onpreventclick; + } + + if (self.rail.drag.dl) { + if (self.rail.drag.dl == "v") nx = self.rail.drag.sl; + else if (self.rail.drag.dl == "h") ny = self.rail.drag.st; + } + + self.synched("touchmove", function () { + if (self.rail.drag && (self.rail.drag.pt == 2)) { + if (self.prepareTransition) self.resetTransition(); + if (self.rail.scrollable) self.setScrollTop(ny); + self.scrollmom.update(fx, fy); + if (self.railh && self.railh.scrollable) { + self.setScrollLeft(nx); + self.showCursor(ny, nx); + } else { + self.showCursor(ny); + } + if (cap.isie10) _doc.selection.clear(); + } + }); + + return self.cancelEvent(e); + + } + else if (self.rail.drag.pt == 1) { // drag on cursor + return self.onmousemove(e); + } + + }; + + self.ontouchstartCursor = function (e, hronly) { + if (self.rail.drag && self.rail.drag.pt != 3) return; + if (self.locked) return self.cancelEvent(e); + self.cancelScroll(); + self.rail.drag = { + x: e.touches[0].clientX, + y: e.touches[0].clientY, + sx: self.scroll.x, + sy: self.scroll.y, + pt: 3, + hr: (!!hronly) + }; + var tg = self.getTarget(e); + if (!self.ispage && cap.hasmousecapture) tg.setCapture(); + if (self.isiframe && !cap.hasmousecapture) { + self.saved.csspointerevents = self.doc.css("pointer-events"); + self.css(self.doc, { "pointer-events": "none" }); + } + return self.cancelEvent(e); + }; + + self.ontouchendCursor = function (e) { + if (self.rail.drag) { + if (cap.hasmousecapture) _doc.releaseCapture(); + if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents); + if (self.rail.drag.pt != 3) return; + self.rail.drag = false; + return self.cancelEvent(e); + } + }; + + self.ontouchmoveCursor = function (e) { + if (self.rail.drag) { + if (self.rail.drag.pt != 3) return; + + self.cursorfreezed = true; + + if (self.rail.drag.hr) { + self.scroll.x = self.rail.drag.sx + (e.touches[0].clientX - self.rail.drag.x); + if (self.scroll.x < 0) self.scroll.x = 0; + var mw = self.scrollvaluemaxw; + if (self.scroll.x > mw) self.scroll.x = mw; + } else { + self.scroll.y = self.rail.drag.sy + (e.touches[0].clientY - self.rail.drag.y); + if (self.scroll.y < 0) self.scroll.y = 0; + var my = self.scrollvaluemax; + if (self.scroll.y > my) self.scroll.y = my; + } + + self.synched('touchmove', function () { + if (self.rail.drag && (self.rail.drag.pt == 3)) { + self.showCursor(); + if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), opt.cursordragspeed); + else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), opt.cursordragspeed); + } + }); + + return self.cancelEvent(e); + } + + }; + + } + + self.onmousedown = function (e, hronly) { + if (self.rail.drag && self.rail.drag.pt != 1) return; + if (self.railslocked) return self.cancelEvent(e); + self.cancelScroll(); + self.rail.drag = { + x: e.clientX, + y: e.clientY, + sx: self.scroll.x, + sy: self.scroll.y, + pt: 1, + hr: hronly || false + }; + var tg = self.getTarget(e); + + if (cap.hasmousecapture) tg.setCapture(); + if (self.isiframe && !cap.hasmousecapture) { + self.saved.csspointerevents = self.doc.css("pointer-events"); + self.css(self.doc, { + "pointer-events": "none" + }); + } + self.hasmoving = false; + return self.cancelEvent(e); + }; + + self.onmouseup = function (e) { + if (self.rail.drag) { + if (self.rail.drag.pt != 1) return true; + + if (cap.hasmousecapture) _doc.releaseCapture(); + if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents); + self.rail.drag = false; + self.cursorfreezed = false; + if (self.hasmoving) self.triggerScrollEnd(); + return self.cancelEvent(e); + } + }; + + self.onmousemove = function (e) { + if (self.rail.drag) { + if (self.rail.drag.pt !== 1) return; + + if (cap.ischrome && e.which === 0) return self.onmouseup(e); + + self.cursorfreezed = true; + + if (!self.hasmoving) self.triggerScrollStart(e.clientX, e.clientY, 0, 0, 0); + + self.hasmoving = true; + + if (self.rail.drag.hr) { + self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x); + if (self.scroll.x < 0) self.scroll.x = 0; + var mw = self.scrollvaluemaxw; + if (self.scroll.x > mw) self.scroll.x = mw; + } else { + self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y); + if (self.scroll.y < 0) self.scroll.y = 0; + var my = self.scrollvaluemax; + if (self.scroll.y > my) self.scroll.y = my; + } + + self.synched('mousemove', function () { + + if (self.cursorfreezed) { + self.showCursor(); + + if (self.rail.drag.hr) { + self.scrollLeft(Math.round(self.scroll.x * self.scrollratio.x)); + } else { + self.scrollTop(Math.round(self.scroll.y * self.scrollratio.y)); + } + + } + }); + + return self.cancelEvent(e); + } + else { + self.checkarea = 0; + } + }; + + if (cap.cantouch || opt.emulatetouch) { + + self.onpreventclick = function (e) { + if (self.preventclick) { + self.preventclick.tg.onclick = self.preventclick.click; + self.preventclick = false; + return self.cancelEvent(e); + } + }; + + self.onclick = (cap.isios) ? false : function (e) { // it needs to check IE11 ??? + if (self.lastmouseup) { + self.lastmouseup = false; + return self.cancelEvent(e); + } else { + return true; + } + }; + + if (opt.grabcursorenabled && cap.cursorgrabvalue) { + self.css((self.ispage) ? self.doc : self.win, { + 'cursor': cap.cursorgrabvalue + }); + self.css(self.rail, { + 'cursor': cap.cursorgrabvalue + }); + } + + } else { + + var checkSelectionScroll = function (e) { + if (!self.selectiondrag) return; + + if (e) { + var ww = self.win.outerHeight(); + var df = (e.pageY - self.selectiondrag.top); + if (df > 0 && df < ww) df = 0; + if (df >= ww) df -= ww; + self.selectiondrag.df = df; + } + if (self.selectiondrag.df === 0) return; + + var rt = -(self.selectiondrag.df*2/6)|0; + self.doScrollBy(rt); + + self.debounced("doselectionscroll", function () { + checkSelectionScroll(); + }, 50); + }; + + if ("getSelection" in _doc) { // A grade - Major browsers + self.hasTextSelected = function () { + return (_doc.getSelection().rangeCount > 0); + }; + } else if ("selection" in _doc) { //IE9- + self.hasTextSelected = function () { + return (_doc.selection.type != "None"); + }; + } else { + self.hasTextSelected = function () { // no support + return false; + }; + } + + self.onselectionstart = function (e) { + // More testing - severe chrome issues + /* + if (!self.haswrapper&&(e.which&&e.which==2)) { // fool browser to manage middle button scrolling + self.win.css({'overflow':'auto'}); + setTimeout(function(){ + self.win.css({'overflow':'hidden'}); + },10); + return true; + } + */ + if (self.ispage) return; + self.selectiondrag = self.win.offset(); + }; + + self.onselectionend = function (e) { + self.selectiondrag = false; + }; + self.onselectiondrag = function (e) { + if (!self.selectiondrag) return; + if (self.hasTextSelected()) self.debounced("selectionscroll", function () { + checkSelectionScroll(e); + }, 250); + }; + } + + if (cap.hasw3ctouch) { //IE11+ + self.css((self.ispage) ? $("html") : self.win, { 'touch-action': 'none' }); + self.css(self.rail, { + 'touch-action': 'none' + }); + self.css(self.cursor, { + 'touch-action': 'none' + }); + self.bind(self.win, "pointerdown", self.ontouchstart); + self.bind(_doc, "pointerup", self.ontouchend); + self.delegate(_doc, "pointermove", self.ontouchmove); + } else if (cap.hasmstouch) { //IE10 + self.css((self.ispage) ? $("html") : self.win, { '-ms-touch-action': 'none' }); + self.css(self.rail, { + '-ms-touch-action': 'none' + }); + self.css(self.cursor, { + '-ms-touch-action': 'none' + }); + self.bind(self.win, "MSPointerDown", self.ontouchstart); + self.bind(_doc, "MSPointerUp", self.ontouchend); + self.delegate(_doc, "MSPointerMove", self.ontouchmove); + self.bind(self.cursor, "MSGestureHold", function (e) { + e.preventDefault(); + }); + self.bind(self.cursor, "contextmenu", function (e) { + e.preventDefault(); + }); + } else if (cap.cantouch) { // smartphones/touch devices + self.bind(self.win, "touchstart", self.ontouchstart, false, true); + self.bind(_doc, "touchend", self.ontouchend, false, true); + self.bind(_doc, "touchcancel", self.ontouchend, false, true); + self.delegate(_doc, "touchmove", self.ontouchmove, false, true); + } + + if (opt.emulatetouch) { + self.bind(self.win, "mousedown", self.ontouchstart, false, true); + self.bind(_doc, "mouseup", self.ontouchend, false, true); + self.bind(_doc, "mousemove", self.ontouchmove, false, true); + } + + if (opt.cursordragontouch || (!cap.cantouch && !opt.emulatetouch)) { + + self.rail.css({ + cursor: "default" + }); + self.railh && self.railh.css({ + cursor: "default" + }); + + self.jqbind(self.rail, "mouseenter", function () { + if (!self.ispage && !self.win.is(":visible")) return false; + if (self.canshowonmouseevent) self.showCursor(); + self.rail.active = true; + }); + self.jqbind(self.rail, "mouseleave", function () { + self.rail.active = false; + if (!self.rail.drag) self.hideCursor(); + }); + + if (opt.sensitiverail) { + self.bind(self.rail, "click", function (e) { + self.doRailClick(e, false, false); + }); + self.bind(self.rail, "dblclick", function (e) { + self.doRailClick(e, true, false); + }); + self.bind(self.cursor, "click", function (e) { + self.cancelEvent(e); + }); + self.bind(self.cursor, "dblclick", function (e) { + self.cancelEvent(e); + }); + } + + if (self.railh) { + self.jqbind(self.railh, "mouseenter", function () { + if (!self.ispage && !self.win.is(":visible")) return false; + if (self.canshowonmouseevent) self.showCursor(); + self.rail.active = true; + }); + self.jqbind(self.railh, "mouseleave", function () { + self.rail.active = false; + if (!self.rail.drag) self.hideCursor(); + }); + + if (opt.sensitiverail) { + self.bind(self.railh, "click", function (e) { + self.doRailClick(e, false, true); + }); + self.bind(self.railh, "dblclick", function (e) { + self.doRailClick(e, true, true); + }); + self.bind(self.cursorh, "click", function (e) { + self.cancelEvent(e); + }); + self.bind(self.cursorh, "dblclick", function (e) { + self.cancelEvent(e); + }); + } + + } + + } + + if (opt.cursordragontouch && (this.istouchcapable || cap.cantouch)) { + self.bind(self.cursor, "touchstart", self.ontouchstartCursor); + self.bind(self.cursor, "touchmove", self.ontouchmoveCursor); + self.bind(self.cursor, "touchend", self.ontouchendCursor); + self.cursorh && self.bind(self.cursorh, "touchstart", function (e) { + self.ontouchstartCursor(e, true); + }); + self.cursorh && self.bind(self.cursorh, "touchmove", self.ontouchmoveCursor); + self.cursorh && self.bind(self.cursorh, "touchend", self.ontouchendCursor); + } + +// if (!cap.cantouch && !opt.emulatetouch) { + if (!opt.emulatetouch && !cap.isandroid && !cap.isios) { + + self.bind((cap.hasmousecapture) ? self.win : _doc, "mouseup", self.onmouseup); + self.bind(_doc, "mousemove", self.onmousemove); + if (self.onclick) self.bind(_doc, "click", self.onclick); + + self.bind(self.cursor, "mousedown", self.onmousedown); + self.bind(self.cursor, "mouseup", self.onmouseup); + + if (self.railh) { + self.bind(self.cursorh, "mousedown", function (e) { + self.onmousedown(e, true); + }); + self.bind(self.cursorh, "mouseup", self.onmouseup); + } + + if (!self.ispage && opt.enablescrollonselection) { + self.bind(self.win[0], "mousedown", self.onselectionstart); + self.bind(_doc, "mouseup", self.onselectionend); + self.bind(self.cursor, "mouseup", self.onselectionend); + if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend); + self.bind(_doc, "mousemove", self.onselectiondrag); + } + + if (self.zoom) { + self.jqbind(self.zoom, "mouseenter", function () { + if (self.canshowonmouseevent) self.showCursor(); + self.rail.active = true; + }); + self.jqbind(self.zoom, "mouseleave", function () { + self.rail.active = false; + if (!self.rail.drag) self.hideCursor(); + }); + } + + } else { + + self.bind((cap.hasmousecapture) ? self.win : _doc, "mouseup", self.ontouchend); + if (self.onclick) self.bind(_doc, "click", self.onclick); + + if (opt.cursordragontouch) { + self.bind(self.cursor, "mousedown", self.onmousedown); + self.bind(self.cursor, "mouseup", self.onmouseup); + self.cursorh && self.bind(self.cursorh, "mousedown", function (e) { + self.onmousedown(e, true); + }); + self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup); + } else { + self.bind(self.rail, "mousedown", function (e) { e.preventDefault(); }); // prevent text selection + self.railh && self.bind(self.railh, "mousedown", function (e) { e.preventDefault(); }); + } + + } + + + if (opt.enablemousewheel) { + if (!self.isiframe) self.mousewheel((cap.isie && self.ispage) ? _doc : self.win, self.onmousewheel); + self.mousewheel(self.rail, self.onmousewheel); + if (self.railh) self.mousewheel(self.railh, self.onmousewheelhr); + } + + if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) { + if (!self.win.attr("tabindex")) self.win.attr({ + "tabindex": ++tabindexcounter + }); + + self.bind(self.win, "focus", function (e) { // better using native events + domfocus = (self.getTarget(e)).id || self.getTarget(e) || false; + self.hasfocus = true; + if (self.canshowonmouseevent) self.noticeCursor(); + }); + self.bind(self.win, "blur", function (e) { // * + domfocus = false; + self.hasfocus = false; + }); + + self.bind(self.win, "mouseenter", function (e) { // * + mousefocus = (self.getTarget(e)).id || self.getTarget(e) || false; + self.hasmousefocus = true; + if (self.canshowonmouseevent) self.noticeCursor(); + }); + self.bind(self.win, "mouseleave", function (e) { // * + mousefocus = false; + self.hasmousefocus = false; + if (!self.rail.drag) self.hideCursor(); + }); + + } + + + //Thanks to http://www.quirksmode.org !! + self.onkeypress = function (e) { + if (self.railslocked && self.page.maxh === 0) return true; + + e = e || _win.event; + var tg = self.getTarget(e); + if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) { + var tp = tg.getAttribute('type') || tg.type || false; + if ((!tp) || !(/submit|button|cancel/i.tp)) return true; + } + + if ($(tg).attr('contenteditable')) return true; + + if (self.hasfocus || (self.hasmousefocus && !domfocus) || (self.ispage && !domfocus && !mousefocus)) { + var key = e.keyCode; + + if (self.railslocked && key != 27) return self.cancelEvent(e); + + var ctrl = e.ctrlKey || false; + var shift = e.shiftKey || false; + + var ret = false; + switch (key) { + case 38: + case 63233: //safari + self.doScrollBy(24 * 3); + ret = true; + break; + case 40: + case 63235: //safari + self.doScrollBy(-24 * 3); + ret = true; + break; + case 37: + case 63232: //safari + if (self.railh) { + (ctrl) ? self.doScrollLeft(0) : self.doScrollLeftBy(24 * 3); + ret = true; + } + break; + case 39: + case 63234: //safari + if (self.railh) { + (ctrl) ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24 * 3); + ret = true; + } + break; + case 33: + case 63276: // safari + self.doScrollBy(self.view.h); + ret = true; + break; + case 34: + case 63277: // safari + self.doScrollBy(-self.view.h); + ret = true; + break; + case 36: + case 63273: // safari + (self.railh && ctrl) ? self.doScrollPos(0, 0) : self.doScrollTo(0); + ret = true; + break; + case 35: + case 63275: // safari + (self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh) : self.doScrollTo(self.page.maxh); + ret = true; + break; + case 32: + if (opt.spacebarenabled) { + (shift) ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h); + ret = true; + } + break; + case 27: // ESC + if (self.zoomactive) { + self.doZoom(); + ret = true; + } + break; + } + if (ret) return self.cancelEvent(e); + } + }; + + if (opt.enablekeyboard) self.bind(_doc, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress); + + self.bind(_doc, "keydown", function (e) { + var ctrl = e.ctrlKey || false; + if (ctrl) self.wheelprevented = true; + }); + self.bind(_doc, "keyup", function (e) { + var ctrl = e.ctrlKey || false; + if (!ctrl) self.wheelprevented = false; + }); + self.bind(_win, "blur", function (e) { + self.wheelprevented = false; + }); + + self.bind(_win, 'resize', self.onscreenresize); + self.bind(_win, 'orientationchange', self.onscreenresize); + + self.bind(_win, "load", self.lazyResize); + + if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26 + var tmp = self.win.attr("style"); + var ww = parseFloat(self.win.css("width")) + 1; + self.win.css('width', ww); + self.synched("chromefix", function () { + self.win.attr("style", tmp); + }); + } + + + // Trying a cross-browser implementation - good luck! + + self.onAttributeChange = function (e) { + self.lazyResize(self.isieold ? 250 : 30); + }; + + if (opt.enableobserver) { + + if ((!self.isie11) && (ClsMutationObserver !== false)) { // IE11 crashes #568 + self.observerbody = new ClsMutationObserver(function (mutations) { + mutations.forEach(function (mut) { + if (mut.type == "attributes") { + return ($body.hasClass("modal-open") && $body.hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0], self.doc[0])) ? self.hide() : self.show(); // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal + } + }); + if (self.me.clientWidth != self.page.width || self.me.clientHeight != self.page.height) return self.lazyResize(30); + }); + self.observerbody.observe(_doc.body, { + childList: true, + subtree: true, + characterData: false, + attributes: true, + attributeFilter: ['class'] + }); + } + + if (!self.ispage && !self.haswrapper) { + + var _dom = self.win[0]; + + // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content + if (ClsMutationObserver !== false) { + self.observer = new ClsMutationObserver(function (mutations) { + mutations.forEach(self.onAttributeChange); + }); + self.observer.observe(_dom, { + childList: true, + characterData: false, + attributes: true, + subtree: false + }); + self.observerremover = new ClsMutationObserver(function (mutations) { + mutations.forEach(function (mo) { + if (mo.removedNodes.length > 0) { + for (var dd in mo.removedNodes) { + if (!!self && (mo.removedNodes[dd] === _dom)) return self.remove(); + } + } + }); + }); + self.observerremover.observe(_dom.parentNode, { + childList: true, + characterData: false, + attributes: false, + subtree: false + }); + } else { + self.bind(_dom, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange); + if (cap.isie9) _dom.attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug + self.bind(_dom, "DOMNodeRemoved", function (e) { + if (e.target === _dom) self.remove(); + }); + } + } + + } + + // + + if (!self.ispage && opt.boxzoom) self.bind(_win, "resize", self.resizeZoom); + if (self.istextarea) { + self.bind(self.win, "keydown", self.lazyResize); + self.bind(self.win, "mouseup", self.lazyResize); + } + + self.lazyResize(30); + + } + + if (this.doc[0].nodeName == 'IFRAME') { + var oniframeload = function () { + self.iframexd = false; + var doc; + try { + doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow._doc; + var a = doc.domain; + } catch (e) { + self.iframexd = true; + doc = false; + } + + if (self.iframexd) { + if ("console" in _win) console.log('NiceScroll error: policy restriced iframe'); + return true; //cross-domain - I can't manage this + } + + self.forcescreen = true; + + if (self.isiframe) { + self.iframe = { + "doc": $(doc), + "html": self.doc.contents().find('html')[0], + "body": self.doc.contents().find('body')[0] + }; + self.getContentSize = function () { + return { + w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth), + h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight) + }; + }; + self.docscroll = $(self.iframe.body); + } + + if (!cap.isios && opt.iframeautoresize && !self.isiframe) { + self.win.scrollTop(0); // reset position + self.doc.height(""); //reset height to fix browser bug + var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight); + self.doc.height(hh); + } + self.lazyResize(30); + + self.css($(self.iframe.body), _scrollyhidden); + + if (cap.isios && self.haswrapper) { + self.css($(doc.body), { + '-webkit-transform': 'translate3d(0,0,0)' + }); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/ + } + + if ('contentWindow' in this) { + self.bind(this.contentWindow, "scroll", self.onscroll); //IE8 & minor + } else { + self.bind(doc, "scroll", self.onscroll); + } + + if (opt.enablemousewheel) { + self.mousewheel(doc, self.onmousewheel); + } + + if (opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress); + + if (cap.cantouch) { + self.bind(doc, "touchstart", self.ontouchstart); + self.bind(doc, "touchmove", self.ontouchmove); + } + else if (opt.emulatetouch) { + self.bind(doc, "mousedown", self.ontouchstart); + self.bind(doc, "mousemove", function (e) { + return self.ontouchmove(e, true); + }); + if (opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), { + 'cursor': cap.cursorgrabvalue + }); + } + + self.bind(doc, "mouseup", self.ontouchend); + + if (self.zoom) { + if (opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom); + if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom); + } + }; + + if (this.doc[0].readyState && this.doc[0].readyState === "complete") { + setTimeout(function () { + oniframeload.call(self.doc[0], false); + }, 500); + } + self.bind(this.doc, "load", oniframeload); + + } + + }; + + this.showCursor = function (py, px) { + if (self.cursortimeout) { + clearTimeout(self.cursortimeout); + self.cursortimeout = 0; + } + if (!self.rail) return; + if (self.autohidedom) { + self.autohidedom.stop().css({ + opacity: opt.cursoropacitymax + }); + self.cursoractive = true; + } + + if (!self.rail.drag || self.rail.drag.pt != 1) { + if (py !== undefined && py !== false) { + self.scroll.y = (py / self.scrollratio.y) | 0; + } + if (px !== undefined) { + self.scroll.x = (px / self.scrollratio.x) | 0; + } + } + + self.cursor.css({ + height: self.cursorheight, + top: self.scroll.y + }); + if (self.cursorh) { + var lx = (self.hasreversehr) ? self.scrollvaluemaxw - self.scroll.x : self.scroll.x; + self.cursorh.css({ + width: self.cursorwidth, + left: (!self.rail.align && self.rail.visibility) ? lx + self.rail.width : lx + }); + self.cursoractive = true; + } + + if (self.zoom) self.zoom.stop().css({ + opacity: opt.cursoropacitymax + }); + }; + + this.hideCursor = function (tm) { + if (self.cursortimeout) return; + if (!self.rail) return; + if (!self.autohidedom) return; + + if (self.hasmousefocus && opt.autohidemode === "leave") return; + self.cursortimeout = setTimeout(function () { + if (!self.rail.active || !self.showonmouseevent) { + self.autohidedom.stop().animate({ + opacity: opt.cursoropacitymin + }); + if (self.zoom) self.zoom.stop().animate({ + opacity: opt.cursoropacitymin + }); + self.cursoractive = false; + } + self.cursortimeout = 0; + }, tm || opt.hidecursordelay); + }; + + this.noticeCursor = function (tm, py, px) { + self.showCursor(py, px); + if (!self.rail.active) self.hideCursor(tm); + }; + + this.getContentSize = + (self.ispage) ? + function () { + return { + w: Math.max(_doc.body.scrollWidth, _doc.documentElement.scrollWidth), + h: Math.max(_doc.body.scrollHeight, _doc.documentElement.scrollHeight) + }; + } : (self.haswrapper) ? + function () { + return { + w: self.doc[0].offsetWidth, + h: self.doc[0].offsetHeight + }; + } : function () { + return { + w: self.docscroll[0].scrollWidth, + h: self.docscroll[0].scrollHeight + }; + }; + + this.onResize = function (e, page) { + + if (!self || !self.win) return false; + + var premaxh = self.page.maxh, + premaxw = self.page.maxw, + previewh = self.view.h, + previeww = self.view.w; + + self.view = { + w: (self.ispage) ? self.win.width() : self.win[0].clientWidth, + h: (self.ispage) ? self.win.height() : self.win[0].clientHeight + }; + + self.page = (page) ? page : self.getContentSize(); + + self.page.maxh = Math.max(0, self.page.h - self.view.h); + self.page.maxw = Math.max(0, self.page.w - self.view.w); + + if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == previeww) && (self.view.h == previewh)) { + // test position + if (!self.ispage) { + var pos = self.win.offset(); + if (self.lastposition) { + var lst = self.lastposition; + if ((lst.top == pos.top) && (lst.left == pos.left)) return self; //nothing to do + } + self.lastposition = pos; + } else { + return self; //nothing to do + } + } + + if (self.page.maxh === 0) { + self.hideRail(); + self.scrollvaluemax = 0; + self.scroll.y = 0; + self.scrollratio.y = 0; + self.cursorheight = 0; + self.setScrollTop(0); + if (self.rail) self.rail.scrollable = false; + } else { + self.page.maxh -= (opt.railpadding.top + opt.railpadding.bottom); + self.rail.scrollable = true; + } + + if (self.page.maxw === 0) { + self.hideRailHr(); + self.scrollvaluemaxw = 0; + self.scroll.x = 0; + self.scrollratio.x = 0; + self.cursorwidth = 0; + self.setScrollLeft(0); + if (self.railh) { + self.railh.scrollable = false; + } + } else { + self.page.maxw -= (opt.railpadding.left + opt.railpadding.right); + if (self.railh) self.railh.scrollable = (opt.horizrailenabled); + } + + self.railslocked = (self.locked) || ((self.page.maxh === 0) && (self.page.maxw === 0)); + if (self.railslocked) { + if (!self.ispage) self.updateScrollBar(self.view); + return false; + } + + if (!self.hidden) { + if (!self.rail.visibility) self.showRail(); + if (self.railh && !self.railh.visibility) self.showRailHr(); + } + + if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20; + + self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h))); + self.cursorheight = (opt.cursorfixedheight) ? opt.cursorfixedheight : Math.max(opt.cursorminheight, self.cursorheight); + + self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w))); + self.cursorwidth = (opt.cursorfixedheight) ? opt.cursorfixedheight : Math.max(opt.cursorminheight, self.cursorwidth); + + self.scrollvaluemax = self.view.h - self.cursorheight - (opt.railpadding.top + opt.railpadding.bottom); + if (!self.hasborderbox) self.scrollvaluemax -= self.cursor[0].offsetHeight - self.cursor[0].clientHeight; + + if (self.railh) { + self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w; + self.scrollvaluemaxw = self.railh.width - self.cursorwidth - (opt.railpadding.left + opt.railpadding.right); + } + + if (!self.ispage) self.updateScrollBar(self.view); + + self.scrollratio = { + x: (self.page.maxw / self.scrollvaluemaxw), + y: (self.page.maxh / self.scrollvaluemax) + }; + + var sy = self.getScrollTop(); + if (sy > self.page.maxh) { + self.doScrollTop(self.page.maxh); + } else { + self.scroll.y = (self.getScrollTop() / self.scrollratio.y) | 0; + self.scroll.x = (self.getScrollLeft() / self.scrollratio.x) | 0; + if (self.cursoractive) self.noticeCursor(); + } + + if (self.scroll.y && (self.getScrollTop() === 0)) self.doScrollTo((self.scroll.y * self.scrollratio.y)|0); + + return self; + }; + + this.resize = self.onResize; + + var hlazyresize = 0; + + this.onscreenresize = function(e) { + clearTimeout(hlazyresize); + + var hiderails = (!self.ispage && !self.haswrapper); + if (hiderails) self.hideRails(); + + hlazyresize = setTimeout(function () { + if (self) { + if (hiderails) self.showRails(); + self.resize(); + } + hlazyresize=0; + }, 120); + }; + + this.lazyResize = function (tm) { // event debounce + + clearTimeout(hlazyresize); + + tm = isNaN(tm) ? 240 : tm; + + hlazyresize = setTimeout(function () { + self && self.resize(); + hlazyresize=0; + }, tm); + + return self; + + }; + + // derived by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel + function _modernWheelEvent(dom, name, fn, bubble) { + self._bind(dom, name, function (e) { + e = e || _win.event; + var event = { + original: e, + target: e.target || e.srcElement, + type: "wheel", + deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1, + deltaX: 0, + deltaZ: 0, + preventDefault: function () { + e.preventDefault ? e.preventDefault() : e.returnValue = false; + return false; + }, + stopImmediatePropagation: function () { + (e.stopImmediatePropagation) ? e.stopImmediatePropagation() : e.cancelBubble = true; + } + }; + + if (name == "mousewheel") { + e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX); + e.wheelDeltaY && (event.deltaY = -1 / 40 * e.wheelDeltaY); + !event.deltaY && !event.deltaX && (event.deltaY = -1 / 40 * e.wheelDelta); + } else { + event.deltaY = e.detail; + } + + return fn.call(dom, event); + }, bubble); + } + + + + this.jqbind = function (dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave) + self.events.push({ + e: dom, + n: name, + f: fn, + q: true + }); + $(dom).on(name, fn); + }; + + this.mousewheel = function (dom, fn, bubble) { // bind mousewheel + var el = ("jquery" in dom) ? dom[0] : dom; + if ("onwheel" in _doc.createElement("div")) { // Modern browsers support "wheel" + self._bind(el, "wheel", fn, bubble || false); + } else { + var wname = (_doc.onmousewheel !== undefined) ? "mousewheel" : "DOMMouseScroll"; // older Webkit+IE support or older Firefox + _modernWheelEvent(el, wname, fn, bubble || false); + if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy + } + }; + + var passiveSupported = false; + + if (cap.haseventlistener) { // W3C standard event model + + // thanks to https://developer.mozilla.org/en-US/docs/Web/API/EventTarget/addEventListener + try { var options = Object.defineProperty({}, "passive", { get: function () { passiveSupported = !0; } }); _win.addEventListener("test", null, options); } catch (err) { } + + this.stopPropagation = function (e) { + if (!e) return false; + e = (e.original) ? e.original : e; + e.stopPropagation(); + return false; + }; + + this.cancelEvent = function(e) { + if (e.cancelable) e.preventDefault(); + e.stopImmediatePropagation(); + if (e.preventManipulation) e.preventManipulation(); // IE10+ + return false; + }; + + } else { + + // inspired from https://gist.github.com/jonathantneal/2415137 + + Event.prototype.preventDefault = function () { + this.returnValue = false; + }; + + Event.prototype.stopPropagation = function () { + this.cancelBubble = true; + }; + + _win.constructor.prototype.addEventListener = _doc.constructor.prototype.addEventListener = Element.prototype.addEventListener = function (type, listener, useCapture) { + this.attachEvent("on" + type, listener); + }; + _win.constructor.prototype.removeEventListener = _doc.constructor.prototype.removeEventListener = Element.prototype.removeEventListener = function (type, listener, useCapture) { + this.detachEvent("on" + type, listener); + }; + + // Thanks to http://www.switchonthecode.com !! + this.cancelEvent = function (e) { + e = e || _win.event; + if (e) { + e.cancelBubble = true; + e.cancel = true; + e.returnValue = false; + } + return false; + }; + + this.stopPropagation = function (e) { + e = e || _win.event; + if (e) e.cancelBubble = true; + return false; + }; + + } + + this.delegate = function (dom, name, fn, bubble, active) { + + var de = delegatevents[name] || false; + + if (!de) { + + de = { + a: [], + l: [], + f: function (e) { + var lst = de.l, l = lst.length - 1; + var r = false; + for (var a = l; a >= 0; a--) { + r = lst[a].call(e.target, e); + if (r === false) return false; + } + return r; + } + }; + + self.bind(dom, name, de.f, bubble, active); + + delegatevents[name] = de; + + } + + if (self.ispage) { + de.a = [self.id].concat(de.a); + de.l = [fn].concat(de.l); + } else { + de.a.push(self.id); + de.l.push(fn); + } + + }; + + this.undelegate = function (dom, name, fn, bubble, active) { + var de = delegatevents[name]||false; + if (de&&de.l) { // quick fix #683 + for (var a=0,l=de.l.length;a 0) return dd; + dom = (dom.parentNode) ? dom.parentNode : false; + } + return false; + }; + + this.triggerScrollStart = function (cx, cy, rx, ry, ms) { + + if (self.onscrollstart) { + var info = { + type: "scrollstart", + current: { + x: cx, + y: cy + }, + request: { + x: rx, + y: ry + }, + end: { + x: self.newscrollx, + y: self.newscrolly + }, + speed: ms + }; + self.onscrollstart.call(self, info); + } + + }; + + this.triggerScrollEnd = function () { + if (self.onscrollend) { + + var px = self.getScrollLeft(); + var py = self.getScrollTop(); + + var info = { + type: "scrollend", + current: { + x: px, + y: py + }, + end: { + x: px, + y: py + } + }; + + self.onscrollend.call(self, info); + + } + + }; + + var scrolldiry = 0, scrolldirx = 0, scrolltmr = 0, scrollspd = 1; + + function doScrollRelative(px, py, chkscroll, iswheel) { + + if (!self.scrollrunning) { + self.newscrolly = self.getScrollTop(); + self.newscrollx = self.getScrollLeft(); + scrolltmr = now(); + } + + var gap = (now() - scrolltmr); + scrolltmr = now(); + + if (gap > 350) { + scrollspd = 1; + } else { + scrollspd += (2 - scrollspd) / 10; + } + + px = px * scrollspd | 0; + py = py * scrollspd | 0; + + if (px) { + + if (iswheel) { // mouse-only + if (px < 0) { // fix apple magic mouse swipe back/forward + if (self.getScrollLeft() >= self.page.maxw) return true; + } else { + if (self.getScrollLeft() <= 0) return true; + } + } + + var dx = px > 0 ? 1 : -1; + + if (scrolldirx !== dx) { + if (self.scrollmom) self.scrollmom.stop(); + self.newscrollx = self.getScrollLeft(); + scrolldirx = dx; + } + + self.lastdeltax -= px; + + } + + if (py) { + + var chk = (function () { + var top = self.getScrollTop(); + if (py < 0) { + if (top >= self.page.maxh) return true; + } else { + if (top <= 0) return true; + } + })(); + + if (chk) { + if (opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) return true; + var ny = self.view.h >> 1; + if (self.newscrolly < -ny) { self.newscrolly = -ny; py = -1; } + else if (self.newscrolly > self.page.maxh + ny) { self.newscrolly = self.page.maxh + ny; py = 1; } + else py = 0; + } + + var dy = py > 0 ? 1 : -1; + + if (scrolldiry !== dy) { + if (self.scrollmom) self.scrollmom.stop(); + self.newscrolly = self.getScrollTop(); + scrolldiry = dy; + } + + self.lastdeltay -= py; + + } + + if (py || px) { + self.synched("relativexy", function () { + + var dty = self.lastdeltay + self.newscrolly; + self.lastdeltay = 0; + + var dtx = self.lastdeltax + self.newscrollx; + self.lastdeltax = 0; + + if (!self.rail.drag) self.doScrollPos(dtx, dty); + + }); + } + + } + + var hasparentscrollingphase = false; + + function execScrollWheel(e, hr, chkscroll) { + var px, py; + + if (!chkscroll && hasparentscrollingphase) return true; + + if (e.deltaMode === 0) { // PIXEL + px = -(e.deltaX * (opt.mousescrollstep / (18 * 3))) | 0; + py = -(e.deltaY * (opt.mousescrollstep / (18 * 3))) | 0; + } else if (e.deltaMode === 1) { // LINE + px = -(e.deltaX * opt.mousescrollstep * 50 / 80) | 0; + py = -(e.deltaY * opt.mousescrollstep * 50 / 80) | 0; + } + + if (hr && opt.oneaxismousemode && (px === 0) && py) { // classic vertical-only mousewheel + browser with x/y support + px = py; + py = 0; + + if (chkscroll) { + var hrend = (px < 0) ? (self.getScrollLeft() >= self.page.maxw) : (self.getScrollLeft() <= 0); + if (hrend) { // preserve vertical scrolling + py = px; + px = 0; + } + } + + } + + // invert horizontal direction for rtl mode + if (self.isrtlmode) px = -px; + + var chk = doScrollRelative(px, py, chkscroll, true); + + if (chk) { + if (chkscroll) hasparentscrollingphase = true; + } else { + hasparentscrollingphase = false; + e.stopImmediatePropagation(); + return e.preventDefault(); + } + + } + + this.onmousewheel = function (e) { + if (self.wheelprevented||self.locked) return false; + if (self.railslocked) { + self.debounced("checkunlock", self.resize, 250); + return false; + } + if (self.rail.drag) return self.cancelEvent(e); + + if (opt.oneaxismousemode === "auto" && e.deltaX !== 0) opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant) + + if (opt.oneaxismousemode && e.deltaX === 0) { + if (!self.rail.scrollable) { + if (self.railh && self.railh.scrollable) { + return self.onmousewheelhr(e); + } else { + return true; + } + } + } + + var nw = now(); + var chk = false; + if (opt.preservenativescrolling && ((self.checkarea + 600) < nw)) { + self.nativescrollingarea = self.isScrollable(e); + chk = true; + } + self.checkarea = nw; + if (self.nativescrollingarea) return true; // this isn't my business + var ret = execScrollWheel(e, false, chk); + if (ret) self.checkarea = 0; + return ret; + }; + + this.onmousewheelhr = function (e) { + if (self.wheelprevented) return; + if (self.railslocked || !self.railh.scrollable) return true; + if (self.rail.drag) return self.cancelEvent(e); + + var nw = now(); + var chk = false; + if (opt.preservenativescrolling && ((self.checkarea + 600) < nw)) { + self.nativescrollingarea = self.isScrollable(e); + chk = true; + } + self.checkarea = nw; + if (self.nativescrollingarea) return true; // this is not my business + if (self.railslocked) return self.cancelEvent(e); + + return execScrollWheel(e, true, chk); + }; + + this.stop = function () { + self.cancelScroll(); + if (self.scrollmon) self.scrollmon.stop(); + self.cursorfreezed = false; + self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y)); + self.noticeCursor(); + return self; + }; + + this.getTransitionSpeed = function (dif) { + + return 80 + (dif / 72) * opt.scrollspeed |0; + + }; + + if (!opt.smoothscroll) { + this.doScrollLeft = function (x, spd) { //direct + var y = self.getScrollTop(); + self.doScrollPos(x, y, spd); + }; + this.doScrollTop = function (y, spd) { //direct + var x = self.getScrollLeft(); + self.doScrollPos(x, y, spd); + }; + this.doScrollPos = function (x, y, spd) { //direct + var nx = (x > self.page.maxw) ? self.page.maxw : x; + if (nx < 0) nx = 0; + var ny = (y > self.page.maxh) ? self.page.maxh : y; + if (ny < 0) ny = 0; + self.synched('scroll', function () { + self.setScrollTop(ny); + self.setScrollLeft(nx); + }); + }; + this.cancelScroll = function () { }; // direct + + } else if (self.ishwscroll && cap.hastransition && opt.usetransition && !!opt.smoothscroll) { + + var lasttransitionstyle = ''; + + this.resetTransition = function () { + lasttransitionstyle = ''; + self.doc.css(cap.prefixstyle + 'transition-duration', '0ms'); + }; + + this.prepareTransition = function (dif, istime) { + var ex = (istime) ? dif : self.getTransitionSpeed(dif); + var trans = ex + 'ms'; + if (lasttransitionstyle !== trans) { + lasttransitionstyle = trans; + self.doc.css(cap.prefixstyle + 'transition-duration', trans); + } + return ex; + }; + + this.doScrollLeft = function (x, spd) { //trans + var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop(); + self.doScrollPos(x, y, spd); + }; + + this.doScrollTop = function (y, spd) { //trans + var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft(); + self.doScrollPos(x, y, spd); + }; + + this.cursorupdate = { + running: false, + start: function () { + var m = this; + + if (m.running) return; + m.running = true; + + var loop = function () { + if (m.running) setAnimationFrame(loop); + self.showCursor(self.getScrollTop(), self.getScrollLeft()); + self.notifyScrollEvent(self.win[0]); + }; + + setAnimationFrame(loop); + }, + stop: function () { + this.running = false; + } + }; + + this.doScrollPos = function (x, y, spd) { //trans + + var py = self.getScrollTop(); + var px = self.getScrollLeft(); + + if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection + + if (!opt.bouncescroll) { + if (y < 0) y = 0; + else if (y > self.page.maxh) y = self.page.maxh; + if (x < 0) x = 0; + else if (x > self.page.maxw) x = self.page.maxw; + } else { + if (y < 0) y = y / 2 | 0; + else if (y > self.page.maxh) y = self.page.maxh + (y - self.page.maxh) / 2 | 0; + if (x < 0) x = x / 2 | 0; + else if (x > self.page.maxw) x = self.page.maxw + (x - self.page.maxw) / 2 | 0; + } + + if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false; + + self.newscrolly = y; + self.newscrollx = x; + + var top = self.getScrollTop(); + var lft = self.getScrollLeft(); + + var dst = {}; + dst.x = x - lft; + dst.y = y - top; + + var dd = Math.sqrt((dst.x * dst.x) + (dst.y * dst.y)) | 0; + + var ms = self.prepareTransition(dd); + + if (!self.scrollrunning) { + self.scrollrunning = true; + self.triggerScrollStart(lft, top, x, y, ms); + self.cursorupdate.start(); + } + + self.scrollendtrapped = true; + + if (!cap.transitionend) { + if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped); + self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event + } + + self.setScrollTop(self.newscrolly); + self.setScrollLeft(self.newscrollx); + + }; + + this.cancelScroll = function () { + if (!self.scrollendtrapped) return true; + var py = self.getScrollTop(); + var px = self.getScrollLeft(); + self.scrollrunning = false; + if (!cap.transitionend) clearTimeout(cap.transitionend); + self.scrollendtrapped = false; + self.resetTransition(); + self.setScrollTop(py); // fire event onscroll + if (self.railh) self.setScrollLeft(px); + if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm); + self.timerscroll = false; + + self.cursorfreezed = false; + + self.cursorupdate.stop(); + self.showCursor(py, px); + return self; + }; + + this.onScrollTransitionEnd = function () { + + if (!self.scrollendtrapped) return; + + var py = self.getScrollTop(); + var px = self.getScrollLeft(); + + if (py < 0) py = 0; + else if (py > self.page.maxh) py = self.page.maxh; + if (px < 0) px = 0; + else if (px > self.page.maxw) px = self.page.maxw; + if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, opt.snapbackspeed); + + if (self.scrollrunning) self.triggerScrollEnd(); + self.scrollrunning = false; + + self.scrollendtrapped = false; + self.resetTransition(); + self.timerscroll = false; + self.setScrollTop(py); // fire event onscroll + if (self.railh) self.setScrollLeft(px); // fire event onscroll left + + self.cursorupdate.stop(); + self.noticeCursor(false, py, px); + + self.cursorfreezed = false; + + }; + + } else { + + this.doScrollLeft = function (x, spd) { //no-trans + var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop(); + self.doScrollPos(x, y, spd); + }; + + this.doScrollTop = function (y, spd) { //no-trans + var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft(); + self.doScrollPos(x, y, spd); + }; + + this.doScrollPos = function (x, y, spd) { //no-trans + + var py = self.getScrollTop(); + var px = self.getScrollLeft(); + + if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection + + var clipped = false; + + if (!self.bouncescroll || !self.rail.visibility) { + if (y < 0) { + y = 0; + clipped = true; + } else if (y > self.page.maxh) { + y = self.page.maxh; + clipped = true; + } + } + if (!self.bouncescroll || !self.railh.visibility) { + if (x < 0) { + x = 0; + clipped = true; + } else if (x > self.page.maxw) { + x = self.page.maxw; + clipped = true; + } + } + + if (self.scrollrunning && (self.newscrolly === y) && (self.newscrollx === x)) return true; + + self.newscrolly = y; + self.newscrollx = x; + + self.dst = {}; + self.dst.x = x - px; + self.dst.y = y - py; + self.dst.px = px; + self.dst.py = py; + + var dd = Math.sqrt((self.dst.x * self.dst.x) + (self.dst.y * self.dst.y)) | 0; + var ms = self.getTransitionSpeed(dd); + + self.bzscroll = {}; + + var p3 = (clipped) ? 1 : 0.58; + self.bzscroll.x = new BezierClass(px, self.newscrollx, ms, 0, 0, p3, 1); + self.bzscroll.y = new BezierClass(py, self.newscrolly, ms, 0, 0, p3, 1); + + var loopid = now(); + + var loop = function () { + + if (!self.scrollrunning) return; + var x = self.bzscroll.y.getPos(); + + self.setScrollLeft(self.bzscroll.x.getNow()); + self.setScrollTop(self.bzscroll.y.getNow()); + + if (x <= 1) { + self.timer = setAnimationFrame(loop); + } else { + self.scrollrunning = false; + self.timer = 0; + self.triggerScrollEnd(); + } + + }; + + if (!self.scrollrunning) { + self.triggerScrollStart(px, py, x, y, ms); + self.scrollrunning = true; + self.timer = setAnimationFrame(loop); + } + + }; + + this.cancelScroll = function () { + if (self.timer) clearAnimationFrame(self.timer); + self.timer = 0; + self.bzscroll = false; + self.scrollrunning = false; + return self; + }; + + } + + this.doScrollBy = function (stp, relative) { + doScrollRelative(0, stp); + }; + + this.doScrollLeftBy = function (stp, relative) { + doScrollRelative(stp, 0); + }; + + this.doScrollTo = function (pos, relative) { + var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos; + if (ny < 0) ny = 0; + else if (ny > self.page.maxh) ny = self.page.maxh; + self.cursorfreezed = false; + self.doScrollTop(pos); + }; + + this.checkContentSize = function () { + var pg = self.getContentSize(); + if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg); + }; + + self.onscroll = function (e) { + if (self.rail.drag) return; + if (!self.cursorfreezed) { + self.synched('scroll', function () { + self.scroll.y = Math.round(self.getScrollTop() / self.scrollratio.y); + if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() / self.scrollratio.x); + self.noticeCursor(); + }); + } + }; + self.bind(self.docscroll, "scroll", self.onscroll); + + this.doZoomIn = function (e) { + if (self.zoomactive) return; + self.zoomactive = true; + + self.zoomrestore = { + style: {} + }; + var lst = ['position', 'top', 'left', 'zIndex', 'backgroundColor', 'marginTop', 'marginBottom', 'marginLeft', 'marginRight']; + var win = self.win[0].style; + for (var a in lst) { + var pp = lst[a]; + self.zoomrestore.style[pp] = (win[pp] !== undefined) ? win[pp] : ''; + } + + self.zoomrestore.style.width = self.win.css('width'); + self.zoomrestore.style.height = self.win.css('height'); + + self.zoomrestore.padding = { + w: self.win.outerWidth() - self.win.width(), + h: self.win.outerHeight() - self.win.height() + }; + + if (cap.isios4) { + self.zoomrestore.scrollTop = $window.scrollTop(); + $window.scrollTop(0); + } + + self.win.css({ + position: (cap.isios4) ? "absolute" : "fixed", + top: 0, + left: 0, + zIndex: globalmaxzindex + 100, + margin: 0 + }); + var bkg = self.win.css("backgroundColor"); + if ("" === bkg || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff"); + self.rail.css({ + zIndex: globalmaxzindex + 101 + }); + self.zoom.css({ + zIndex: globalmaxzindex + 102 + }); + self.zoom.css('backgroundPosition', '0 -18px'); + self.resizeZoom(); + + if (self.onzoomin) self.onzoomin.call(self); + + return self.cancelEvent(e); + }; + + this.doZoomOut = function (e) { + if (!self.zoomactive) return; + self.zoomactive = false; + + self.win.css("margin", ""); + self.win.css(self.zoomrestore.style); + + if (cap.isios4) { + $window.scrollTop(self.zoomrestore.scrollTop); + } + + self.rail.css({ + "z-index": self.zindex + }); + self.zoom.css({ + "z-index": self.zindex + }); + self.zoomrestore = false; + self.zoom.css('backgroundPosition', '0 0'); + self.onResize(); + + if (self.onzoomout) self.onzoomout.call(self); + + return self.cancelEvent(e); + }; + + this.doZoom = function (e) { + return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e); + }; + + this.resizeZoom = function () { + if (!self.zoomactive) return; + + var py = self.getScrollTop(); //preserve scrolling position + self.win.css({ + width: $window.width() - self.zoomrestore.padding.w + "px", + height: $window.height() - self.zoomrestore.padding.h + "px" + }); + self.onResize(); + + self.setScrollTop(Math.min(self.page.maxh, py)); + }; + + this.init(); + + $.nicescroll.push(this); + + }; + + // Inspired by the work of Kin Blas + // http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js + var ScrollMomentumClass2D = function (nc) { + var self = this; + this.nc = nc; + + this.lastx = 0; + this.lasty = 0; + this.speedx = 0; + this.speedy = 0; + this.lasttime = 0; + this.steptime = 0; + this.snapx = false; + this.snapy = false; + this.demulx = 0; + this.demuly = 0; + + this.lastscrollx = -1; + this.lastscrolly = -1; + + this.chkx = 0; + this.chky = 0; + + this.timer = 0; + + this.reset = function (px, py) { + self.stop(); + self.steptime = 0; + self.lasttime = now(); + self.speedx = 0; + self.speedy = 0; + self.lastx = px; + self.lasty = py; + self.lastscrollx = -1; + self.lastscrolly = -1; + }; + + this.update = function (px, py) { + var tm = now(); + self.steptime = tm - self.lasttime; + self.lasttime = tm; + var dy = py - self.lasty; + var dx = px - self.lastx; + var sy = self.nc.getScrollTop(); + var sx = self.nc.getScrollLeft(); + var newy = sy + dy; + var newx = sx + dx; + self.snapx = (newx < 0) || (newx > self.nc.page.maxw); + self.snapy = (newy < 0) || (newy > self.nc.page.maxh); + self.speedx = dx; + self.speedy = dy; + self.lastx = px; + self.lasty = py; + }; + + this.stop = function () { + self.nc.unsynched("domomentum2d"); + if (self.timer) clearTimeout(self.timer); + self.timer = 0; + self.lastscrollx = -1; + self.lastscrolly = -1; + }; + + this.doSnapy = function (nx, ny) { + var snap = false; + + if (ny < 0) { + ny = 0; + snap = true; + } else if (ny > self.nc.page.maxh) { + ny = self.nc.page.maxh; + snap = true; + } + + if (nx < 0) { + nx = 0; + snap = true; + } else if (nx > self.nc.page.maxw) { + nx = self.nc.page.maxw; + snap = true; + } + + (snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed) : self.nc.triggerScrollEnd(); + }; + + this.doMomentum = function (gp) { + var t = now(); + var l = (gp) ? t + gp : self.lasttime; + + var sl = self.nc.getScrollLeft(); + var st = self.nc.getScrollTop(); + + var pageh = self.nc.page.maxh; + var pagew = self.nc.page.maxw; + + self.speedx = (pagew > 0) ? Math.min(60, self.speedx) : 0; + self.speedy = (pageh > 0) ? Math.min(60, self.speedy) : 0; + + var chk = l && (t - l) <= 60; + + if ((st < 0) || (st > pageh) || (sl < 0) || (sl > pagew)) chk = false; + + var sy = (self.speedy && chk) ? self.speedy : false; + var sx = (self.speedx && chk) ? self.speedx : false; + + if (sy || sx) { + var tm = Math.max(16, self.steptime); //timeout granularity + + if (tm > 50) { // do smooth + var xm = tm / 50; + self.speedx *= xm; + self.speedy *= xm; + tm = 50; + } + + self.demulxy = 0; + + self.lastscrollx = self.nc.getScrollLeft(); + self.chkx = self.lastscrollx; + self.lastscrolly = self.nc.getScrollTop(); + self.chky = self.lastscrolly; + + var nx = self.lastscrollx; + var ny = self.lastscrolly; + + var onscroll = function () { + var df = ((now() - t) > 600) ? 0.04 : 0.02; + + if (self.speedx) { + nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy))); + self.lastscrollx = nx; + if ((nx < 0) || (nx > pagew)) df = 0.10; + } + + if (self.speedy) { + ny = Math.floor(self.lastscrolly - (self.speedy * (1 - self.demulxy))); + self.lastscrolly = ny; + if ((ny < 0) || (ny > pageh)) df = 0.10; + } + + self.demulxy = Math.min(1, self.demulxy + df); + + self.nc.synched("domomentum2d", function () { + + if (self.speedx) { + var scx = self.nc.getScrollLeft(); + // if (scx != self.chkx) self.stop(); + self.chkx = nx; + self.nc.setScrollLeft(nx); + } + + if (self.speedy) { + var scy = self.nc.getScrollTop(); + // if (scy != self.chky) self.stop(); + self.chky = ny; + self.nc.setScrollTop(ny); + } + + if (!self.timer) { + self.nc.hideCursor(); + self.doSnapy(nx, ny); + } + + }); + + if (self.demulxy < 1) { + self.timer = setTimeout(onscroll, tm); + } else { + self.stop(); + self.nc.hideCursor(); + self.doSnapy(nx, ny); + } + }; + + onscroll(); + + } else { + self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop()); + } + + }; + + }; + + + // override jQuery scrollTop + var _scrollTop = jQuery.fn.scrollTop; // preserve original function + + jQuery.cssHooks.pageYOffset = { + get: function (elem, computed, extra) { + var nice = $.data(elem, '__nicescroll') || false; + return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem); + }, + set: function (elem, value) { + var nice = $.data(elem, '__nicescroll') || false; + (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem, value); + return this; + } + }; + + jQuery.fn.scrollTop = function (value) { + if (value === undefined) { + var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false; + return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this); + } else { + return this.each(function () { + var nice = $.data(this, '__nicescroll') || false; + (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call($(this), value); + }); + } + }; + + // override jQuery scrollLeft + var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function + + $.cssHooks.pageXOffset = { + get: function (elem, computed, extra) { + var nice = $.data(elem, '__nicescroll') || false; + return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem); + }, + set: function (elem, value) { + var nice = $.data(elem, '__nicescroll') || false; + (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem, value); + return this; + } + }; + + jQuery.fn.scrollLeft = function (value) { + if (value === undefined) { + var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false; + return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this); + } else { + return this.each(function () { + var nice = $.data(this, '__nicescroll') || false; + (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call($(this), value); + }); + } + }; + + var NiceScrollArray = function (doms) { + var self = this; + this.length = 0; + this.name = "nicescrollarray"; + + this.each = function (fn) { + $.each(self, fn); + return self; + }; + + this.push = function (nice) { + self[self.length] = nice; + self.length++; + }; + + this.eq = function (idx) { + return self[idx]; + }; + + if (doms) { + for (var a = 0; a < doms.length; a++) { + var nice = $.data(doms[a], '__nicescroll') || false; + if (nice) { + this[this.length] = nice; + this.length++; + } + } + } + + return this; + }; + + function mplex(el, lst, fn) { + for (var a = 0, l = lst.length; a < l; a++) fn(el, lst[a]); + } + mplex( + NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'], + function (e, n) { + e[n] = function () { + var args = arguments; + return this.each(function () { + this[n].apply(this, args); + }); + }; + } + ); + + jQuery.fn.getNiceScroll = function (index) { + if (index === undefined) { + return new NiceScrollArray(this); + } else { + return this[index] && $.data(this[index], '__nicescroll') || false; + } + }; + + var pseudos = jQuery.expr.pseudos || jQuery.expr[':']; // jQuery 3 migration + pseudos.nicescroll = function (a) { + return $.data(a, '__nicescroll') !== undefined; + }; + + $.fn.niceScroll = function (wrapper, _opt) { + if (_opt === undefined && typeof wrapper == "object" && !("jquery" in wrapper)) { + _opt = wrapper; + wrapper = false; + } + + var ret = new NiceScrollArray(); + + this.each(function () { + var $this = $(this); + + var opt = $.extend({}, _opt); // cloning + + if (wrapper || false) { + var wrp = $(wrapper); + opt.doc = (wrp.length > 1) ? $(wrapper, $this) : wrp; + opt.win = $this; + } + var docundef = !("doc" in opt); + if (!docundef && !("win" in opt)) opt.win = $this; + + var nice = $this.data('__nicescroll') || false; + if (!nice) { + opt.doc = opt.doc || $this; + nice = new NiceScrollClass(opt, $this); + $this.data('__nicescroll', nice); + } + ret.push(nice); + }); + + return (ret.length === 1) ? ret[0] : ret; + }; + + _win.NiceScroll = { + getjQuery: function () { + return jQuery; + } + }; + + if (!$.nicescroll) { + $.nicescroll = new NiceScrollArray(); + $.nicescroll.options = _globaloptions; + } + +})); \ No newline at end of file diff --git a/src/main/resources/static/route/web/detail.html b/src/main/resources/static/route/web/detail.html index d428e27..0fe1bf1 100644 --- a/src/main/resources/static/route/web/detail.html +++ b/src/main/resources/static/route/web/detail.html @@ -27,7 +27,7 @@
  • - +
    相关通知

    各部门通知公告

    diff --git a/src/main/resources/static/route/web/public.html b/src/main/resources/static/route/web/public.html index f99e31d..3167a06 100644 --- a/src/main/resources/static/route/web/public.html +++ b/src/main/resources/static/route/web/public.html @@ -116,7 +116,8 @@
    功能一览
    -
    +
    +
    {{nav.name}}
      @@ -154,6 +155,8 @@
    +
    +
    @@ -252,6 +255,7 @@
    +